CAS 929202-07-3
:(2S)-2-amino(4,4,4-~2~H_3_)butanoic acid
Description:
(2S)-2-amino(4,4,4-trideuterobutanoic acid), with the CAS number 929202-07-3, is an amino acid derivative characterized by its chiral center at the second carbon atom, which is in the S configuration. This compound features a primary amine group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, contributing to its classification as a proteinogenic amino acid. The presence of three deuterium atoms (indicated by the trideuterobutanoic acid designation) suggests that this compound is isotopically labeled, which can be useful in various biochemical and analytical applications, such as NMR spectroscopy or metabolic studies. The structure includes a four-carbon backbone, with the amino group attached to the second carbon and the carboxylic acid at the terminal end. This compound is likely to exhibit properties typical of amino acids, including solubility in water and the ability to participate in peptide bond formation. Its isotopic labeling may also influence its physical and chemical properties, such as mass and reactivity, making it a valuable tool in research and development.
Formula:C4H6D3NO2
InChI:InChI=1/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1/i1D3
SMILES:C(C[C@@H](C(=O)O)N)([2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
L-Aminobutyric Acid-d3
CAS:Controlled Product<p>Applications Receptor antagonist.<br>References Porter, D.J.T., et al.: Biochem. Pharmacol., 50, 1475 (1995),<br></p>Formula:C42H3H6NO2Color and Shape:White To Off-WhiteMolecular weight:106.14
