CAS 92923-44-9
:gadolinium sodium 2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl)tetraacetate (1:1:1)
Description:
Gadolinium sodium 2,2',2'',2'''-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrayl)tetraacetate (CAS 92923-44-9) is a coordination compound that features gadolinium, a lanthanide metal known for its paramagnetic properties, which make it useful in magnetic resonance imaging (MRI) as a contrast agent. The compound is characterized by its complex structure, which includes a tetraazacyclododecane ligand that coordinates with the gadolinium ion through multiple nitrogen atoms, enhancing the stability and solubility of the complex in aqueous solutions. The presence of acetate groups contributes to the overall charge balance and solubility in biological systems. This compound is typically studied for its potential applications in medical imaging and targeted drug delivery due to its ability to form stable complexes and its favorable biocompatibility. Additionally, the paramagnetic nature of gadolinium enhances the relaxation properties of nearby water protons, making it an effective contrast agent in MRI. Safety and handling precautions are essential due to the toxicity associated with gadolinium and its compounds.
Formula:C16H24GdN4NaO8
InChI:InChI=1/C16H28N4O8.Gd.Na/c21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26;;/h1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28);;/q;+3;+1/p-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.