
CAS 929249-84-3
:2-Chloro-1-(2,6-difluorophenyl)ethanone
Description:
2-Chloro-1-(2,6-difluorophenyl)ethanone is an organic compound characterized by its unique structure, which includes a chloro group and a difluorophenyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It has a moderate molecular weight and exhibits properties common to halogenated ketones, such as reactivity in nucleophilic substitution reactions due to the presence of the electrophilic carbonyl group. The difluorophenyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of chlorine and fluorine atoms can enhance its stability and alter its interaction with biological targets. Safety data sheets would indicate that it should be handled with care, as halogenated compounds can pose health risks. Overall, 2-Chloro-1-(2,6-difluorophenyl)ethanone is a compound of interest in various chemical research applications, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H5ClF2O
InChI:InChI=1S/C8H5ClF2O/c9-4-7(12)8-5(10)2-1-3-6(8)11/h1-3H,4H2
InChI key:InChIKey=TXGWOJUWPACPCQ-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(F)C=CC=C1F
Synonyms:- 2-Chloro-1-(2,6-difluorophenyl)ethan-1-one
- Ethanone, 2-chloro-1-(2,6-difluorophenyl)-
- 2-Chloro-1-(2,6-difluorophenyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.