CAS 929250-35-1
:6-Benzyloxypyridine-3-boronic acid
Description:
6-Benzyloxypyridine-3-boronic acid is an organoboron compound characterized by the presence of a pyridine ring substituted with a benzyloxy group and a boronic acid functional group. The molecular structure features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for coordination with metal ions. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The benzyloxy group enhances the compound's lipophilicity, potentially improving its bioavailability. This compound is often utilized in cross-coupling reactions, particularly in the Suzuki-Miyaura reaction, which is a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, its unique structural features may impart specific biological activities, making it a candidate for further research in drug development and material science. Overall, 6-Benzyloxypyridine-3-boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C12H12BNO3
InChI:InChI=1/C12H12BNO3/c15-13(16)11-6-7-12(14-8-11)17-9-10-4-2-1-3-5-10/h1-8,15-16H,9H2
SMILES:c1ccc(cc1)COc1ccc(cn1)B(O)O
Synonyms:- [6-(Benzyloxy)pyridin-3-yl]boronic acid
- Boronic acid, B-[6-(phenylmethoxy)-3-pyridinyl]-
- 6-Benzyloxypyridin-3-ylboronic acid
- 6-Benzyloxypyridine-3-boronicaci
- 6-Benzyloxypyridine-3-boronic Acid (contains varying amounts of Anhydride)
- 6-(benzyloxy)pyridin-3-yl-3-boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Benzyloxy-pyridine-5-boronic acid
CAS:Formula:C12H12BNO3Purity:98%Color and Shape:SolidMolecular weight:229.03962-(Benzyloxy)pyridine-5-boronic acid
CAS:2-(Benzyloxy)pyridine-5-boronic acidPurity:98%Molecular weight:229.04g/mol6-Benzyloxypyridine-3-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C12H12BNO3Purity:98.0 to 108.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:229.046-(Benzyloxy)pyridine-3-boronic acid
CAS:Formula:C12H12BNO3Purity:97%Color and Shape:SolidMolecular weight:229.04




