CymitQuimica logo

CAS 92929-53-8

:

4-Pyridazinecarboxylic acid, 5-methyl-, ethyl ester

Description:
4-Pyridazinecarboxylic acid, 5-methyl-, ethyl ester, with the CAS number 92929-53-8, is an organic compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a carboxylic acid functional group and an ethyl ester moiety, contributing to its reactivity and solubility properties. Typically, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. The presence of the methyl group at the 5-position of the pyridazine ring can influence the compound's physical and chemical properties, such as its boiling point and solubility in various solvents. Additionally, compounds with pyridazine structures are of interest in medicinal chemistry due to their potential biological activities. Overall, 4-Pyridazinecarboxylic acid, 5-methyl-, ethyl ester is a versatile compound with applications in organic synthesis and potentially in pharmaceuticals.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-3-12-8(11)7-5-10-9-4-6(7)2/h4-5H,3H2,1-2H3
InChI key:IXOIGNZETIAWGN-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CN=NC=C1C
Found 4 products.