CymitQuimica logo

CAS 92932-74-6

:

D,L-1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid hydrochloride

Description:
D,L-1,2,3,4-Tetrahydroisoquinoline-1-carboxylic acid hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a tetrahydroisoquinoline moiety and a carboxylic acid functional group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in aqueous solutions. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various biologically active molecules. The presence of the carboxylic acid group contributes to its acidic properties, while the tetrahydroisoquinoline structure may influence its interaction with biological targets. The compound is often studied for its role in neuropharmacology and may exhibit various biological activities, including effects on neurotransmitter systems. As with many organic compounds, it is essential to handle it with care, considering safety data and proper laboratory protocols. Its CAS number, 92932-74-6, serves as a unique identifier for regulatory and research purposes.
Formula:C10H11NO2.HCl
InChI:InChI=1S/C10H11NO2.ClH/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9;/h1-4,9,11H,5-6H2,(H,12,13);1H
InChI key:PMPYPSNDPNMYIO-UHFFFAOYSA-N
SMILES:C1CNC(C2=CC=CC=C21)C(=O)O.Cl
Synonyms:
  • 1-Tic.HCl
Found 3 products.