CymitQuimica logo

CAS 929339-23-1

:

2-[3-(2-Furanyl)-2-propen-1-ylidene]-6-hydroxy-3(2H)-benzofuranone

Description:
2-[3-(2-Furanyl)-2-propen-1-ylidene]-6-hydroxy-3(2H)-benzofuranone, with the CAS number 929339-23-1, is a synthetic organic compound characterized by its complex structure, which includes a benzofuranone core and a furan moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential antioxidant and anti-inflammatory activities. The presence of the hydroxy group suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the conjugated double bond system involving the propenylidene group may contribute to its electronic properties, potentially allowing for interactions with biological targets. The compound's unique structure may also impart specific optical properties, making it of interest in various fields, including medicinal chemistry and materials science. Overall, its characteristics make it a subject of interest for further research into its potential applications and biological activities.
Formula:C15H10O4
InChI:InChI=1S/C15H10O4/c16-10-6-7-12-14(9-10)19-13(15(12)17)5-1-3-11-4-2-8-18-11/h1-9,16H
InChI key:InChIKey=UWPJFGPAYRLAJH-UHFFFAOYSA-N
SMILES:O=C1C=2C(OC1=CC=CC3=CC=CO3)=CC(O)=CC2
Synonyms:
  • 3(2H)-Benzofuranone, 2-[3-(2-furanyl)-2-propen-1-ylidene]-6-hydroxy-
  • 2-[3-(2-Furanyl)-2-propen-1-ylidene]-6-hydroxy-3(2H)-benzofuranone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.