
CAS 929341-57-1
:5-(Difluoromethoxy)-2-methylbenzenesulfonyl chloride
Description:
5-(Difluoromethoxy)-2-methylbenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides and other derivatives. The presence of the difluoromethoxy group enhances its electrophilic properties, making it a useful intermediate in synthetic organic chemistry. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and storage conditions. It is soluble in organic solvents such as dichloromethane and acetone but is generally insoluble in water due to its hydrophobic aromatic structure. The compound should be handled with care, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Its applications may include use in pharmaceuticals, agrochemicals, and as a reagent in organic synthesis, particularly in the introduction of sulfonyl groups into various substrates. Proper safety measures should be observed when working with this compound due to its reactive nature.
Formula:C8H7ClF2O3S
InChI:InChI=1S/C8H7ClF2O3S/c1-5-2-3-6(14-8(10)11)4-7(5)15(9,12)13/h2-4,8H,1H3
InChI key:InChIKey=QMVXRACKLPKVET-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=CC(OC(F)F)=CC=C1C
Synonyms:- Benzenesulfonyl chloride, 5-(difluoromethoxy)-2-methyl-
- 5-(Difluoromethoxy)-2-methylbenzenesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Difluoromethoxy)-2-methylbenzenesulfonyl chloride
CAS:<p>5-(Difluoromethoxy)-2-methylbenzenesulfonyl chloride</p>Molecular weight:256.65419g/mol

