CAS 92953-15-6
:4-[(methylsulfonyl)sulfanyl]butanoic acid
Description:
4-[(Methylsulfonyl)sulfanyl]butanoic acid, identified by its CAS number 92953-15-6, is an organic compound characterized by the presence of both a carboxylic acid functional group and a sulfonyl group. This compound features a butanoic acid backbone, which consists of a four-carbon chain, with a methylsulfonyl group attached to the sulfur atom. The presence of the methylsulfonyl group imparts unique chemical properties, including increased solubility in polar solvents and potential reactivity in various chemical reactions. The compound is likely to exhibit moderate acidity due to the carboxylic acid group, which can donate protons in solution. Additionally, the sulfonyl group may enhance the compound's ability to participate in nucleophilic substitution reactions. Its structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, where sulfonyl-containing compounds are often utilized for their biological activity. Overall, 4-[(methylsulfonyl)sulfanyl]butanoic acid is a versatile compound with interesting chemical properties stemming from its functional groups.
Formula:C5H10O4S2
InChI:InChI=1/C5H10O4S2/c1-11(8,9)10-4-2-3-5(6)7/h2-4H2,1H3,(H,6,7)
SMILES:CS(=O)(=O)SCCCC(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Carboxypropyl Methanethiosulfonate
CAS:Controlled ProductFormula:C5H10O4S2Color and Shape:NeatMolecular weight:198.26
