
CAS 929617-31-2
:5-Bromo-3-chloro-1H-pyrazolo[3,4-c]pyridine
Description:
5-Bromo-3-chloro-1H-pyrazolo[3,4-c]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound features both bromine and chlorine substituents, which can influence its reactivity and solubility. Typically, such halogenated compounds exhibit enhanced biological activity, making them of interest in medicinal chemistry and drug development. The presence of the pyrazolo and pyridine moieties may also impart specific electronic properties, affecting how the compound interacts with biological targets. In terms of physical properties, it is likely to be a solid at room temperature, with moderate solubility in organic solvents. The compound's structure suggests potential applications in various fields, including pharmaceuticals, agrochemicals, and materials science. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental concerns. Overall, 5-Bromo-3-chloro-1H-pyrazolo[3,4-c]pyridine represents a versatile scaffold for further chemical modifications and applications.
Formula:C6H3BrClN3
InChI:InChI=1S/C6H3BrClN3/c7-5-1-3-4(2-9-5)10-11-6(3)8/h1-2H,(H,10,11)
InChI key:InChIKey=DLSRNINJBNNCRD-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CN=C(Br)C2)NN1
Synonyms:- 5-Bromo-3-chloro-1H-pyrazolo[3,4-c]pyridine
- 1H-Pyrazolo[3,4-c]pyridine, 5-bromo-3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
