
CAS 929617-37-8
:1,1-Dimethylethyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate
Description:
1,1-Dimethylethyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate, with the CAS number 929617-37-8, is a synthetic organic compound characterized by its complex structure, which includes an indazole ring system. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of a bromine atom and a trifluoromethyl group enhances its chemical stability and may influence its biological activity, making it of interest in medicinal chemistry. The tert-butyl group (1,1-dimethylethyl) provides steric hindrance, which can affect the compound's interaction with biological targets. Typically, compounds of this nature are evaluated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in various research applications, particularly in the development of new therapeutic agents. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and disposal.
Formula:C13H12BrF3N2O2
InChI:InChI=1S/C13H12BrF3N2O2/c1-12(2,3)21-11(20)19-9-5-4-7(14)6-8(9)10(18-19)13(15,16)17/h4-6H,1-3H3
InChI key:InChIKey=AKGPQEYHTMUPHV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C(C(F)(F)F)=N1)=CC(Br)=CC2
Synonyms:- 1-N-Boc-5-bromo-3-trifluoromethyl-1H-indazole
- 1,1-Dimethylethyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate
- 1H-Indazole-1-carboxylic acid, 5-bromo-3-(trifluoromethyl)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
tert-Butyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate
CAS:Formula:C13H12BrF3N2O2Molecular weight:365.1458tert-Butyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate
CAS:<p>tert-Butyl 5-bromo-3-(trifluoromethyl)-1H-indazole-1-carboxylate</p>Molecular weight:365.14579g/mol


