CAS 92973-26-7
:5-(3-Chlorophenyl)-2-furoyl chloride
Description:
5-(3-Chlorophenyl)-2-furoyl chloride, with the CAS number 92973-26-7, is an organic compound characterized by its furoyl chloride structure, which features a furan ring substituted with a chlorophenyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which makes it a useful intermediate in organic synthesis, especially in the preparation of various pharmaceuticals and agrochemicals. The chlorophenyl substituent enhances its electrophilic character, allowing it to participate in nucleophilic acyl substitution reactions. Additionally, this compound may exhibit moderate to high toxicity, necessitating careful handling and storage under appropriate safety protocols. Its solubility is generally higher in organic solvents than in water, which is common for acyl chlorides. Overall, 5-(3-Chlorophenyl)-2-furoyl chloride is a valuable compound in synthetic organic chemistry, with applications that leverage its reactive properties.
Formula:C11H6Cl2O2
InChI:InChI=1/C11H6Cl2O2/c12-8-3-1-2-7(6-8)9-4-5-10(15-9)11(13)14/h1-6H
SMILES:c1cc(cc(c1)Cl)c1ccc(C(=O)Cl)o1
Synonyms:- 2-Furancarbonyl Chloride, 5-(3-Chlorophenyl)-
- 5-(3-Chlorophenyl)Furan-2-Carbonyl Chloride
- 5-(3-Chlorophenyl)-2-furoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
