CymitQuimica logo

CAS 92992-17-1

:

1-(methoxycarbonyl)-2,3-dihydro-1H-pyrrolizine-7-carboxylic acid

Description:
1-(Methoxycarbonyl)-2,3-dihydro-1H-pyrrolizine-7-carboxylic acid, with the CAS number 92992-17-1, is a chemical compound characterized by its unique bicyclic structure, which includes a pyrrolizine ring system. This compound features both a methoxycarbonyl group and a carboxylic acid functional group, contributing to its potential reactivity and solubility in various solvents. The presence of these functional groups suggests that it may participate in various chemical reactions, such as esterification or amidation. The dihydro configuration indicates that the compound has two hydrogen atoms added to the pyrrolizine ring, which can influence its stability and reactivity. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural characteristics may also allow for interactions with biological targets, potentially leading to therapeutic applications. Overall, this compound's unique features make it a subject of interest in both synthetic and applied chemistry contexts.
Formula:C10H11NO4
InChI:InChI=1/C10H11NO4/c1-15-10(14)7-3-5-11-4-2-6(8(7)11)9(12)13/h2,4,7H,3,5H2,1H3,(H,12,13)
SMILES:COC(=O)C1CCn2ccc(c12)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.