CAS 92992-86-4

N1-(3,5-Dimethyl-2-pyridinyl)-1,3-propanediamine

Description:

N1-(3,5-Dimethyl-2-pyridinyl)-1,3-propanediamine, with the CAS number 92992-86-4, is an organic compound characterized by its structure, which includes a propanediamine backbone substituted with a 3,5-dimethyl-2-pyridinyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the pyridine ring contributes to its aromatic character and may impart specific reactivity, particularly in coordination chemistry or as a ligand in metal complexes. Additionally, the dimethyl substitutions on the pyridine ring can affect the steric and electronic properties of the molecule, potentially enhancing its biological activity or interaction with other chemical species. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific applications would depend on further research into its properties and behavior in various chemical contexts.

Formula: C₁₀H₁₇N₃

InChI: InChI=1S/C10H17N3/c1-8-6-9(2)10(13-7-8)12-5-3-4-11/h6-7H,3-5,11H2,1-2H3,(H,12,13)

InChI key: InChIKey=KPBPCAUWKPKPBL-UHFFFAOYSA-N

SMILES: N(CCCN)C1=C(C)C=C(C)C=N1

Synonyms:

• 1,3-Propanediamine, N1-(3,5-dimethyl-2-pyridinyl)-
• 2-(3-Aminopropylamino)-3,5-dimethylpyridine
• N1-(3,5-Dimethyl-2-pyridinyl)-1,3-propanediamine
• 1,3-Propanediamine, N-(3,5-dimethyl-2-pyridinyl)-