CAS 929971-57-3
:5,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine
Description:
5,7-Dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrazole and pyrimidine moieties. This compound features two methyl groups at the 5 and 7 positions of the pyrazolo ring, contributing to its overall stability and potentially influencing its biological activity. The tetrahydro configuration indicates that the compound is saturated, which may enhance its solubility and reactivity compared to unsaturated analogs. It is often studied for its potential pharmacological properties, including effects on the central nervous system or as a scaffold for drug development. The presence of nitrogen atoms in the ring structure may also impart specific chemical reactivity and interactions with biological targets. As with many heterocycles, the compound's properties can be influenced by factors such as substituents, stereochemistry, and the presence of functional groups, making it a subject of interest in medicinal chemistry and drug design.
Formula:C8H13N3
InChI:InChI=1/C8H13N3/c1-6-5-7(2)11-8(10-6)3-4-9-11/h3-4,6-7,10H,5H2,1-2H3
SMILES:CC1CC(C)n2c(ccn2)N1
Synonyms:- Pyrazolo[1,5-A]Pyrimidine, 4,5,6,7-Tetrahydro-5,7-Dimethyl-
- 5,7-Dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,7-Dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine
CAS:Formula:C8H13N3Molecular weight:151.2089
