CAS 929972-16-7
:4-Fluoro-α-(fluoromethyl)benzenemethanamine
Description:
4-Fluoro-α-(fluoromethyl)benzenemethanamine, identified by its CAS number 929972-16-7, is a chemical compound characterized by the presence of a fluorine atom at the para position of a benzene ring and an amino group attached to a carbon chain that includes a fluoromethyl group. This compound is part of the class of aromatic amines, which are known for their diverse applications in pharmaceuticals and agrochemicals. The presence of multiple fluorine atoms can enhance the lipophilicity and metabolic stability of the compound, potentially influencing its biological activity. The molecular structure suggests that it may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine substituents. Additionally, the compound's reactivity may be influenced by the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 4-Fluoro-α-(fluoromethyl)benzenemethanamine is a compound of interest for further research in medicinal chemistry and material science.
Formula:C8H9F2N
InChI:InChI=1S/C8H9F2N/c9-5-8(11)6-1-3-7(10)4-2-6/h1-4,8H,5,11H2
InChI key:InChIKey=YOYLKDHQGZBJMV-UHFFFAOYSA-N
SMILES:C(CF)(N)C1=CC=C(F)C=C1
Synonyms:- 2-Fluoro-1-(4-fluorophenyl)ethylamine
- Benzenemethanamine, 4-fluoro-α-(fluoromethyl)-
- 4-Fluoro-α-(fluoromethyl)benzenemethanamine
- 2-Fluoro-1-(4-fluorophenyl)ethanamine
- 2-Fluoro-1-(4-fluorophenyl)ethan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.