
CAS 929972-58-7
:1-[5-(4-Bromophenyl)-1,3,4-oxadiazol-2-yl]-2-chloroethanone
Description:
1-[5-(4-Bromophenyl)-1,3,4-oxadiazol-2-yl]-2-chloroethanone, with the CAS number 929972-58-7, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and a chloroethanone moiety. The presence of the 4-bromophenyl group contributes to its potential reactivity and biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen and oxygen in its ring structure. It may exhibit various properties such as moderate solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic nature of the chloroethanone group. The oxadiazole ring is known for its applications in pharmaceuticals and agrochemicals, often associated with antimicrobial and anti-inflammatory activities. Additionally, the bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and material science.
Formula:C10H6BrClN2O2
InChI:InChI=1S/C10H6BrClN2O2/c11-7-3-1-6(2-4-7)9-13-14-10(16-9)8(15)5-12/h1-4H,5H2
InChI key:InChIKey=XKPPRJWVGYBJIB-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C=1OC(=NN1)C2=CC=C(Br)C=C2
Synonyms:- 1-[5-(4-Bromophenyl)-1,3,4-oxadiazol-2-yl]-2-chloroethanone
- Ethanone, 1-[5-(4-bromophenyl)-1,3,4-oxadiazol-2-yl]-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.