
CAS 929973-03-5
:2-Hydrazinyl-5-(1-pyrrolidinylsulfonyl)benzoxazole
Description:
2-Hydrazinyl-5-(1-pyrrolidinylsulfonyl)benzoxazole is a chemical compound characterized by its unique structure, which includes a benzoxazole ring fused with a hydrazine and a pyrrolidine sulfonyl group. This compound typically exhibits properties associated with both hydrazine derivatives and benzoxazole derivatives, such as potential biological activity and the ability to form hydrogen bonds due to the presence of nitrogen and sulfur atoms. The hydrazine moiety may contribute to its reactivity, while the benzoxazole ring can enhance its stability and lipophilicity. Additionally, the sulfonyl group can influence solubility and interaction with biological targets. Compounds like this are often studied for their potential pharmaceutical applications, including antimicrobial, anticancer, or anti-inflammatory properties. However, specific characteristics such as melting point, solubility, and spectral data would require experimental determination or literature references for precise values. Overall, 2-Hydrazinyl-5-(1-pyrrolidinylsulfonyl)benzoxazole represents a class of compounds with diverse applications in medicinal chemistry.
Formula:C11H14N4O3S
InChI:InChI=1S/C11H14N4O3S/c12-14-11-13-9-7-8(3-4-10(9)18-11)19(16,17)15-5-1-2-6-15/h3-4,7H,1-2,5-6,12H2,(H,13,14)
InChI key:InChIKey=UBZWUPRKKIWIJS-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C=1C=C2C(OC(=NN)N2)=CC1)N3CCCC3
Synonyms:- 2-Hydrazinyl-5-(1-pyrrolidinylsulfonyl)benzoxazole
- Benzoxazole, 2-hydrazinyl-5-(1-pyrrolidinylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.