CAS 929973-37-5
:2-[(2-Chloroacetyl)amino]-N-(3,4-difluorophenyl)acetamide
Description:
2-[(2-Chloroacetyl)amino]-N-(3,4-difluorophenyl)acetamide, with the CAS number 929973-37-5, is a synthetic organic compound characterized by its amide functional group and the presence of both chloroacetyl and difluorophenyl substituents. This compound typically exhibits moderate to high solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The chloroacetyl moiety contributes to its reactivity, potentially allowing for further chemical modifications or interactions in biological systems. The difluorophenyl group may enhance lipophilicity and influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. Additionally, the presence of fluorine atoms can impart unique electronic properties, affecting the compound's reactivity and stability. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its biological activity and safety profile.
Formula:C10H9ClF2N2O2
InChI:InChI=1S/C10H9ClF2N2O2/c11-4-9(16)14-5-10(17)15-6-1-2-7(12)8(13)3-6/h1-3H,4-5H2,(H,14,16)(H,15,17)
InChI key:InChIKey=IFHUSKKVKRQDBS-UHFFFAOYSA-N
SMILES:N(C(CNC(CCl)=O)=O)C1=CC(F)=C(F)C=C1
Synonyms:- 2-[(2-Chloroacetyl)amino]-N-(3,4-difluorophenyl)acetamide
- Acetamide, 2-[(2-chloroacetyl)amino]-N-(3,4-difluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.