
CAS 929973-40-0
:N-[1-[4-(Aminosulfonyl)phenyl]ethyl]-2-chloroacetamide
Description:
N-[1-[4-(Aminosulfonyl)phenyl]ethyl]-2-chloroacetamide, with the CAS number 929973-40-0, is a chemical compound characterized by its specific functional groups and structural features. It contains an aminosulfonyl group, which contributes to its potential biological activity, particularly in pharmaceutical applications. The presence of a chloroacetamide moiety suggests that it may exhibit reactivity typical of acetamides, potentially participating in nucleophilic substitution reactions. This compound is likely to be a solid at room temperature, with solubility influenced by the presence of polar functional groups. Its molecular structure indicates that it may interact with biological targets, making it of interest in medicinal chemistry. The compound's properties, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the environment in which it is studied. Overall, N-[1-[4-(Aminosulfonyl)phenyl]ethyl]-2-chloroacetamide represents a class of compounds that may have significant implications in drug development and therapeutic applications.
Formula:C10H13ClN2O3S
InChI:InChI=1S/C10H13ClN2O3S/c1-7(13-10(14)6-11)8-2-4-9(5-3-8)17(12,15)16/h2-5,7H,6H2,1H3,(H,13,14)(H2,12,15,16)
InChI key:InChIKey=GOWUFDVJHORVNU-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)(C)C1=CC=C(S(N)(=O)=O)C=C1
Synonyms:- N-[1-[4-(Aminosulfonyl)phenyl]ethyl]-2-chloroacetamide
- Acetamide, N-[1-[4-(aminosulfonyl)phenyl]ethyl]-2-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.