CymitQuimica logo

CAS 929973-43-3

:

3-[(2-Chloroacetyl)amino]-N,N-diethylbenzamide

Description:
3-[(2-Chloroacetyl)amino]-N,N-diethylbenzamide, identified by its CAS number 929973-43-3, is a chemical compound that features a benzamide structure with specific substituents that impart unique properties. This compound contains a diethylamino group, which enhances its lipophilicity, potentially affecting its solubility and permeability in biological systems. The presence of a chloroacetyl group introduces reactivity, making it a candidate for various chemical transformations. Its molecular structure suggests that it may exhibit biological activity, possibly as a pharmaceutical agent or in agrochemical applications. The chloroacetyl moiety can also influence the compound's interaction with biological targets, potentially affecting its pharmacodynamics. Additionally, the compound's characteristics, such as melting point, boiling point, and spectral properties, would be determined by its specific molecular interactions and the presence of functional groups. Overall, 3-[(2-Chloroacetyl)amino]-N,N-diethylbenzamide is a compound of interest in medicinal chemistry and may have implications in drug development or chemical synthesis.
Formula:C13H17ClN2O2
InChI:InChI=1S/C13H17ClN2O2/c1-3-16(4-2)13(18)10-6-5-7-11(8-10)15-12(17)9-14/h5-8H,3-4,9H2,1-2H3,(H,15,17)
InChI key:InChIKey=QXCDNGZFLXCDTR-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=CC(NC(CCl)=O)=CC=C1
Synonyms:
  • 3-[(2-Chloroacetyl)amino]-N,N-diethylbenzamide
  • Benzamide, 3-[(2-chloroacetyl)amino]-N,N-diethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.