CymitQuimica logo

CAS 929973-80-8

:

5,6,7,8-Tetrahydro-2-(1-piperidinyl)pyrido[4,3-d]pyrimidine

Description:
5,6,7,8-Tetrahydro-2-(1-piperidinyl)pyrido[4,3-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and solubility. The piperidinyl group attached to the pyridine moiety enhances its potential for biological activity, making it of interest in medicinal chemistry. The presence of nitrogen atoms in both the pyridine and pyrimidine rings can influence its reactivity and interaction with biological targets, such as receptors or enzymes. This compound may exhibit properties such as being a potential ligand or inhibitor in various biochemical pathways. Its unique structure allows for diverse applications, particularly in drug development, where it may serve as a scaffold for designing new therapeutic agents. As with many heterocycles, its pharmacological profile would depend on the specific substituents and functional groups present, which can modulate its activity and selectivity.
Formula:C12H18N4
InChI:InChI=1S/C12H18N4/c1-2-6-16(7-3-1)12-14-9-10-8-13-5-4-11(10)15-12/h9,13H,1-8H2
InChI key:InChIKey=PTAKQILBTVWZGJ-UHFFFAOYSA-N
SMILES:C=1(N=C2C(=CN1)CNCC2)N3CCCCC3
Synonyms:
  • 5,6,7,8-Tetrahydro-2-(1-piperidinyl)pyrido[4,3-d]pyrimidine
  • Pyrido[4,3-d]pyrimidine, 5,6,7,8-tetrahydro-2-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.