CAS 929973-86-4

5,6,7,8-Tetrahydro-2-(4-methyl-1-piperazinyl)-6-quinazolinamine

Description:

5,6,7,8-Tetrahydro-2-(4-methyl-1-piperazinyl)-6-quinazolinamine is a chemical compound characterized by its complex structure, which includes a quinazoline core fused with a tetrahydro moiety and a piperazine substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. Its molecular structure suggests it may interact with biological systems, possibly acting as a pharmacophore in medicinal chemistry. The presence of the piperazine ring often indicates potential for neuroactive properties, as piperazines are commonly found in various pharmaceuticals. Additionally, the compound may exhibit basicity due to the nitrogen atoms in the piperazine and quinazoline rings, which can participate in hydrogen bonding and ionic interactions. Its specific applications and biological activity would depend on further studies, including pharmacological profiling and toxicity assessments. Overall, this compound represents a class of heterocyclic compounds that are of interest in drug discovery and development.

Formula: C₁₃H₂₁N₅

InChI: InChI=1S/C13H21N5/c1-17-4-6-18(7-5-17)13-15-9-10-8-11(14)2-3-12(10)16-13/h9,11H,2-8,14H2,1H3

InChI key: InChIKey=QYAUUAPOMDVJGU-UHFFFAOYSA-N

SMILES: NC1CC=2C(=NC(=NC2)N3CCN(C)CC3)CC1

Synonyms:

• 5,6,7,8-Tetrahydro-2-(4-methyl-1-piperazinyl)-6-quinazolinamine
• 6-Quinazolinamine, 5,6,7,8-tetrahydro-2-(4-methyl-1-piperazinyl)-