CAS 929973-90-0

4-(Chloromethyl)-N-(phenylmethyl)-2-thiazoleacetamide

Description:

4-(Chloromethyl)-N-(phenylmethyl)-2-thiazoleacetamide is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the phenylmethyl group contributes to its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. The amide functional group in the structure indicates that it can participate in hydrogen bonding, which may affect its interactions with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and biological activities would depend on further research and characterization, including studies on its synthesis, stability, and reactivity under different conditions. As with many thiazole derivatives, it may also possess antimicrobial or anticancer properties, but detailed studies would be necessary to elucidate its full potential and mechanisms of action.

Formula: C₁₃H₁₃ClN₂OS

InChI: InChI=1S/C13H13ClN2OS/c14-7-11-9-18-13(16-11)6-12(17)15-8-10-4-2-1-3-5-10/h1-5,9H,6-8H2,(H,15,17)

InChI key: InChIKey=CKGITUMKOXIMFA-UHFFFAOYSA-N

SMILES: C(C(NCC1=CC=CC=C1)=O)C2=NC(CCl)=CS2

Synonyms:

• 4-(Chloromethyl)-N-(phenylmethyl)-2-thiazoleacetamide
• 2-Thiazoleacetamide, 4-(chloromethyl)-N-(phenylmethyl)-