CAS 929973-91-1

3-[(2-Chloroacetyl)(4-fluorophenyl)amino]propanamide

Description:

3-[(2-Chloroacetyl)(4-fluorophenyl)amino]propanamide, identified by its CAS number 929973-91-1, is a synthetic organic compound characterized by its amide functional group and the presence of both a chloroacetyl and a fluorophenyl moiety. This compound features a propanamide backbone, which contributes to its potential biological activity. The chloroacetyl group is known for its reactivity, often participating in nucleophilic substitution reactions, while the 4-fluorophenyl group may influence the compound's lipophilicity and biological interactions. The presence of the chlorine and fluorine substituents can enhance the compound's pharmacological properties, potentially affecting its binding affinity to biological targets. The compound's structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, making it essential to consider these factors in practical applications. Overall, this compound exemplifies the complexity and potential utility of halogenated amides in chemical and pharmaceutical research.

Formula: C₁₁H₁₂ClFN₂O₂

InChI: InChI=1S/C11H12ClFN2O2/c12-7-11(17)15(6-5-10(14)16)9-3-1-8(13)2-4-9/h1-4H,5-7H2,(H2,14,16)

InChI key: InChIKey=NVKKHWGEEJXFIS-UHFFFAOYSA-N

SMILES: N(CCC(N)=O)(C(CCl)=O)C1=CC=C(F)C=C1

Synonyms:

• Propanamide, 3-[(2-chloroacetyl)(4-fluorophenyl)amino]-
• 3-[(2-Chloroacetyl)(4-fluorophenyl)amino]propanamide