CAS 929973-94-4

2-Chloro-1-(3,4-dihydro-6-nitro-1(2H)-quinolinyl)ethanone

Description:

2-Chloro-1-(3,4-dihydro-6-nitro-1(2H)-quinolinyl)ethanone, with the CAS number 929973-94-4, is a chemical compound characterized by its unique structure that includes a chloro group and a quinoline derivative. This compound typically exhibits properties associated with both halogenated and nitrogen-containing organic compounds. It is likely to be a solid at room temperature and may have moderate solubility in organic solvents, depending on its specific functional groups. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions. Additionally, the quinoline moiety may impart biological activity, making this compound of interest in medicinal chemistry. Its synthesis and handling would require standard laboratory safety protocols due to the presence of halogens and nitro groups, which can be hazardous. Overall, 2-Chloro-1-(3,4-dihydro-6-nitro-1(2H)-quinolinyl)ethanone represents a complex organic molecule with potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₁H₁₁ClN₂O₃

InChI: InChI=1S/C11H11ClN2O3/c12-7-11(15)13-5-1-2-8-6-9(14(16)17)3-4-10(8)13/h3-4,6H,1-2,5,7H2

InChI key: InChIKey=NVQFDNIBMSEAIY-UHFFFAOYSA-N

SMILES: C(CCl)(=O)N1C=2C(=CC(N(=O)=O)=CC2)CCC1

Synonyms:

• 2-Chloro-1-(6-nitro-1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one
• Ethanone, 2-chloro-1-(3,4-dihydro-6-nitro-1(2H)-quinolinyl)-
• 2-Chloro-1-(3,4-dihydro-6-nitro-1(2H)-quinolinyl)ethanone
• 2-Chloro-1-(6-nitro-3,4-dihydroquinolin-1(2H)-yl)ethanone