CymitQuimica logo

CAS 929973-98-8

:

2-[(3-Chloro-1-oxopropyl)amino]-3-thiophenecarboxamide

Description:
2-[(3-Chloro-1-oxopropyl)amino]-3-thiophenecarboxamide, identified by its CAS number 929973-98-8, is a chemical compound characterized by its unique structural features. It contains a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur, contributing to its potential biological activity. The presence of a carboxamide functional group indicates that it can engage in hydrogen bonding, enhancing its solubility and reactivity. The chloro and oxopropyl substituents suggest that the compound may exhibit specific reactivity patterns, potentially making it useful in medicinal chemistry or as a synthetic intermediate. Its molecular structure implies that it may interact with biological targets, which could be of interest in drug development. Additionally, the compound's stability, solubility, and reactivity would depend on the surrounding conditions, such as pH and temperature. Overall, this compound's unique combination of functional groups and heterocyclic structure positions it as a candidate for further investigation in various chemical and pharmaceutical applications.
Formula:C8H9ClN2O2S
InChI:InChI=1S/C8H9ClN2O2S/c9-3-1-6(12)11-8-5(7(10)13)2-4-14-8/h2,4H,1,3H2,(H2,10,13)(H,11,12)
InChI key:InChIKey=ZVQRKXCWWIVCSS-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(NC(CCCl)=O)SC=C1
Synonyms:
  • 2-[(3-Chloro-1-oxopropyl)amino]-3-thiophenecarboxamide
  • 3-Thiophenecarboxamide, 2-[(3-chloro-1-oxopropyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.