CAS 929974-18-5

2-Amino-4-methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid

Description:

2-Amino-4-methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features an amino group, a methoxy group, and a carboxylic acid functional group, contributing to its potential biological activity. The presence of the amino and carboxylic acid groups suggests that it may exhibit properties typical of amino acids, such as solubility in water and the ability to participate in hydrogen bonding. The methoxy group can influence the compound's electronic properties and steric hindrance, potentially affecting its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to interactions with various biological pathways. Its specific applications and biological activities would depend on further research and characterization, including studies on its pharmacokinetics and pharmacodynamics.

Formula: C₉H₁₀N₄O₃

InChI: InChI=1S/C9H10N4O3/c1-13-5(8(14)15)3-4-6(13)11-9(10)12-7(4)16-2/h3H,1-2H3,(H,14,15)(H2,10,11,12)

InChI key: InChIKey=ACTUWXJIXYKPJY-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(N(C)C(C(O)=O)=C2)=NC(N)=N1

Synonyms:

• 7H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 2-amino-4-methoxy-7-methyl-
• 2-Amino-4-methoxy-7-methyl-7H-pyrrolo[2,3-d]pyrimidine-6-carboxylic acid