
CAS 929974-26-5
:3-Amino-1,5,6,7,8,8a-hexahydro-1-oxo-2-indolizinecarbonitrile
Description:
3-Amino-1,5,6,7,8,8a-hexahydro-1-oxo-2-indolizinecarbonitrile is a chemical compound characterized by its complex bicyclic structure, which includes an indolizine moiety. This compound features an amino group and a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the hexahydro framework indicates that it is a saturated derivative, which may influence its physical properties, such as solubility and stability. The oxo group suggests that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Due to its unique structure, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its CAS number, 929974-26-5, allows for easy identification and retrieval of information regarding its synthesis, applications, and safety data. Overall, this compound's characteristics position it as a potentially valuable entity in research and development within the fields of organic and medicinal chemistry.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c10-5-6-8(13)7-3-1-2-4-12(7)9(6)11/h7H,1-4,11H2
InChI key:InChIKey=BLCSFJYUSIXJHF-UHFFFAOYSA-N
SMILES:O=C1C2N(C(N)=C1C#N)CCCC2
Synonyms:- 3-Amino-1,5,6,7,8,8a-hexahydro-1-oxo-2-indolizinecarbonitrile
- 2-Indolizinecarbonitrile, 3-amino-1,5,6,7,8,8a-hexahydro-1-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.