CAS 929974-42-5

2-Amino-4,5-dihydro-4-oxo-5-phenyl-1H-pyrrole-3-carbonitrile

Description:

2-Amino-4,5-dihydro-4-oxo-5-phenyl-1H-pyrrole-3-carbonitrile is a heterocyclic organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. This compound features an amino group (-NH2), a carbonitrile group (-C≡N), and a phenyl substituent, contributing to its diverse chemical reactivity and potential biological activity. The presence of the carbonitrile group suggests that it may participate in nucleophilic reactions, while the amino group can act as a site for hydrogen bonding and further functionalization. The compound's structure indicates it may exhibit properties such as solubility in polar solvents and potential interactions with biological targets, making it of interest in medicinal chemistry. Its unique combination of functional groups may also impart specific pharmacological properties, warranting further investigation for applications in drug development or as a synthetic intermediate in organic synthesis. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is handled or utilized.

Formula: C₁₁H₉N₃O

InChI: InChI=1S/C11H9N3O/c12-6-8-10(15)9(14-11(8)13)7-4-2-1-3-5-7/h1-5,9,14H,13H2

InChI key: InChIKey=MDQAHYKAQDUQEY-UHFFFAOYSA-N

SMILES: O=C1C(NC(N)=C1C#N)C2=CC=CC=C2

Synonyms:

• 2-Amino-4,5-dihydro-4-oxo-5-phenyl-1H-pyrrole-3-carbonitrile
• 1H-Pyrrole-3-carbonitrile, 2-amino-4,5-dihydro-4-oxo-5-phenyl-