CAS 929974-50-5

2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carbonitrile

Description:

2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carbonitrile, with the CAS number 929974-50-5, is a chemical compound characterized by its complex structure, which includes a pyrrole ring fused with an indole moiety. This compound features an amino group and a carbonitrile functional group, contributing to its potential reactivity and biological activity. The presence of the indole structure suggests possible interactions with biological systems, as indoles are known for their roles in various pharmacological activities. The compound's unique arrangement of functional groups may impart specific properties such as solubility, stability, and reactivity, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the carbonitrile group may enhance its ability to participate in nucleophilic reactions. Overall, this compound's intricate structure and functional diversity position it as a candidate for further research in the fields of organic synthesis and pharmacology.

Formula: C₁₄H₁₂N₄O

InChI: InChI=1S/C14H12N4O/c15-6-10-13(19)12(18-14(10)16)5-8-7-17-11-4-2-1-3-9(8)11/h1-4,7,12,17-18H,5,16H2

InChI key: InChIKey=RCOVMDZKKXMDSE-UHFFFAOYSA-N

SMILES: C(C=1C=2C(NC1)=CC=CC2)C3C(=O)C(C#N)=C(N)N3

Synonyms:

• 2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carbonitrile
• 1H-Pyrrole-3-carbonitrile, 2-amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-