
CAS 929974-70-9
:2-Amino-4-oxo-1-azaspiro[4.5]dec-2-ene-3-carboxamide
Description:
2-Amino-4-oxo-1-azaspiro[4.5]dec-2-ene-3-carboxamide is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an amine and a carboxamide functional group. This compound features a bicyclic framework that contributes to its potential biological activity and chemical reactivity. The presence of the amino group suggests it may participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The carbonyl group in the 4-oxo position enhances its reactivity, potentially allowing for further derivatization. Additionally, the spiro structure can influence the compound's conformational flexibility and steric properties, which are important in drug design and development. The compound's molecular formula and specific stereochemistry can affect its solubility, stability, and interaction with biological targets. Overall, 2-Amino-4-oxo-1-azaspiro[4.5]dec-2-ene-3-carboxamide represents a class of compounds that may exhibit interesting pharmacological properties, warranting further investigation in medicinal chemistry and related fields.
Formula:C10H15N3O2
InChI:InChI=1S/C10H15N3O2/c11-8-6(9(12)15)7(14)10(13-8)4-2-1-3-5-10/h13H,1-5,11H2,(H2,12,15)
InChI key:InChIKey=BWONCUVDQFBLDN-UHFFFAOYSA-N
SMILES:O=C1C2(NC(N)=C1C(N)=O)CCCCC2
Synonyms:- 1-Azaspiro[4.5]dec-2-ene-3-carboxamide, 2-amino-4-oxo-
- 2-Amino-4-oxo-1-azaspiro[4.5]dec-2-ene-3-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.