CAS 929974-82-3

2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carboxamide

Description:

2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carboxamide, with the CAS number 929974-82-3, is a chemical compound characterized by its complex structure, which includes a pyrrole ring fused with an indole moiety. This compound features an amino group and a carboxamide functional group, contributing to its potential biological activity. The presence of the indole group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in polar solvents due to its functional groups, and its stability may be influenced by environmental factors such as pH and temperature. Additionally, the presence of multiple heteroatoms in its structure may confer unique reactivity and interaction properties. Overall, this compound's characteristics suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. However, specific biological activity and toxicity profiles would require further investigation through experimental studies.

Formula: C₁₄H₁₄N₄O₂

InChI: InChI=1S/C14H14N4O2/c15-13-11(14(16)20)12(19)10(18-13)5-7-6-17-9-4-2-1-3-8(7)9/h1-4,6,10,17-18H,5,15H2,(H2,16,20)

InChI key: InChIKey=FPIFZVBAGIYARD-UHFFFAOYSA-N

SMILES: C(C=1C=2C(NC1)=CC=CC2)C3C(=O)C(C(N)=O)=C(N)N3

Synonyms:

• 2-Amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-1H-pyrrole-3-carboxamide
• 1H-Pyrrole-3-carboxamide, 2-amino-4,5-dihydro-5-(1H-indol-3-ylmethyl)-4-oxo-