CymitQuimica logo

CAS 929974-93-6

:

3-[3-(Trifluoromethyl)phenyl]-2-propyn-1-amine

Description:
3-[3-(Trifluoromethyl)phenyl]-2-propyn-1-amine, with the CAS number 929974-93-6, is an organic compound characterized by its unique structural features. It contains a propynyl amine functional group, which is notable for its alkyne moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of a trifluoromethyl group attached to a phenyl ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its properties, such as solubility and melting point, can vary based on the specific environment and conditions. Additionally, the trifluoromethyl group can impart unique electronic properties, potentially affecting the compound's interactions with biological targets or its behavior in chemical reactions. Overall, 3-[3-(Trifluoromethyl)phenyl]-2-propyn-1-amine represents a versatile structure with implications in various fields, including pharmaceuticals and materials science.
Formula:C10H8F3N
InChI:InChI=1S/C10H8F3N/c11-10(12,13)9-5-1-3-8(7-9)4-2-6-14/h1,3,5,7H,6,14H2
InChI key:InChIKey=DSWJTEWSTNBRHW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C#CCN)=CC=C1
Synonyms:
  • 2-Propyn-1-amine, 3-[3-(trifluoromethyl)phenyl]-
  • 3-[3-(Trifluoromethyl)phenyl]-2-propyn-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.