CAS 929974-96-9

4-(2-Amino-4-thiazolyl)-1H-pyrrole-2-carboxylic acid

Description:

4-(2-Amino-4-thiazolyl)-1H-pyrrole-2-carboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrrole ring and a thiazole moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of carboxylic acid and amino functional groups. The thiazole ring contributes to its biological activity, making it of interest in pharmaceutical research, particularly for its potential antimicrobial or anticancer properties. The presence of the amino group may enhance its reactivity and ability to form hydrogen bonds, influencing its interactions in biological systems. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including those typical of amino acids and heterocycles. Overall, 4-(2-Amino-4-thiazolyl)-1H-pyrrole-2-carboxylic acid is a compound of interest in medicinal chemistry, with characteristics that may be leveraged for drug development and other applications.

Formula: C₈H₇N₃O₂S

InChI: InChI=1S/C8H7N3O2S/c9-8-11-6(3-14-8)4-1-5(7(12)13)10-2-4/h1-3,10H,(H2,9,11)(H,12,13)

InChI key: InChIKey=BBQCPOHKJHYDFG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CN1)C=2N=C(N)SC2

Synonyms:

• 1H-Pyrrole-2-carboxylic acid, 4-(2-amino-4-thiazolyl)-
• 4-(2-Amino-4-thiazolyl)-1H-pyrrole-2-carboxylic acid