CAS 929974-99-2

2-[(4-Fluorophenoxy)methyl]-4-thiazoleacetic acid

Description:

2-[(4-Fluorophenoxy)methyl]-4-thiazoleacetic acid, identified by its CAS number 929974-99-2, is a chemical compound characterized by its thiazole and phenoxy functional groups. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals. The presence of the fluorine atom in the para position of the phenoxy group can influence the compound's electronic properties, potentially enhancing its biological activity or solubility. The thiazole ring contributes to the compound's stability and reactivity, often participating in various chemical reactions. Additionally, the carboxylic acid group in the structure imparts acidic characteristics, allowing for interactions with biological targets or other chemical species. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific biological activity and safety profiles would require further investigation through empirical studies.

Formula: C₁₂H₁₀FNO₃S

InChI: InChI=1S/C12H10FNO3S/c13-8-1-3-10(4-2-8)17-6-11-14-9(7-18-11)5-12(15)16/h1-4,7H,5-6H2,(H,15,16)

InChI key: InChIKey=PYFGUQFDSHGREN-UHFFFAOYSA-N

SMILES: C(OC1=CC=C(F)C=C1)C2=NC(CC(O)=O)=CS2

Synonyms:

• 4-Thiazoleacetic acid, 2-[(4-fluorophenoxy)methyl]-
• 2-[(4-Fluorophenoxy)methyl]-4-thiazoleacetic acid