CAS 929975-20-2

5,7-Dimethoxy-3-cinnolinecarboxylic acid

Description:

5,7-Dimethoxy-3-cinnolinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cinnoline ring system and two methoxy groups attached to the 5 and 7 positions. This compound is typically classified as an aromatic carboxylic acid due to the presence of the carboxylic acid functional group (-COOH). The methoxy groups contribute to its solubility and reactivity, influencing its interaction with various biological systems. The compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of the cinnoline moiety may impart specific electronic and steric properties that can affect its behavior in chemical reactions. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Overall, 5,7-Dimethoxy-3-cinnolinecarboxylic acid represents a versatile compound with potential utility in various scientific fields.

Formula: C₁₁H₁₀N₂O₄

InChI: InChI=1S/C11H10N2O4/c1-16-6-3-8-7(10(4-6)17-2)5-9(11(14)15)13-12-8/h3-5H,1-2H3,(H,14,15)

InChI key: InChIKey=NSCWKRULMBQTRF-UHFFFAOYSA-N

SMILES: O(C)C=1C2=C(C=C(OC)C1)N=NC(C(O)=O)=C2

Synonyms:

• 5,7-Dimethoxy-3-cinnolinecarboxylic acid
• 3-Cinnolinecarboxylic acid, 5,7-dimethoxy-