CAS 929975-33-7
:5-(1H-Imidazol-2-yl)-4-phenyl-2-thiazolamine
Description:
5-(1H-Imidazol-2-yl)-4-phenyl-2-thiazolamine is a chemical compound characterized by its unique structural features, which include an imidazole ring, a phenyl group, and a thiazole moiety. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The imidazole ring is known for its role in various biological systems, often contributing to enzyme activity and interactions with biomolecules. The thiazole component can enhance the compound's ability to participate in coordination chemistry and may influence its solubility and reactivity. Additionally, the phenyl group can provide stability and affect the compound's electronic properties. Overall, 5-(1H-Imidazol-2-yl)-4-phenyl-2-thiazolamine may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H10N4S
InChI:InChI=1S/C12H10N4S/c13-12-16-9(8-4-2-1-3-5-8)10(17-12)11-14-6-7-15-11/h1-7H,(H2,13,16)(H,14,15)
InChI key:InChIKey=YOBHWHHXOSTSQI-UHFFFAOYSA-N
SMILES:NC=1SC(=C(N1)C2=CC=CC=C2)C=3NC=CN3
Synonyms:- 2-Thiazolamine, 5-(1H-imidazol-2-yl)-4-phenyl-
- 5-(1H-Imidazol-2-yl)-4-phenyl-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.