CAS 929975-45-1

6-(Aminosulfonyl)-2-oxo-3(2H)-benzoxazolepropanoic acid

Description:

6-(Aminosulfonyl)-2-oxo-3(2H)-benzoxazolepropanoic acid, identified by its CAS number 929975-45-1, is a chemical compound characterized by its unique structural features, which include a benzoxazole ring fused with a propanoic acid moiety. This compound contains an aminosulfonyl group, which contributes to its potential biological activity and solubility properties. The presence of the oxo group indicates that it may participate in various chemical reactions, including nucleophilic attacks and hydrogen bonding. Its molecular structure suggests that it may exhibit both acidic and basic properties, making it a zwitterionic compound under certain conditions. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Additionally, its solubility in polar solvents may facilitate its use in various formulations. Overall, the characteristics of this compound make it a subject of interest for further research in pharmacology and related fields.

Formula: C₁₀H₁₀N₂O₆S

InChI: InChI=1S/C10H10N2O6S/c11-19(16,17)6-1-2-7-8(5-6)18-10(15)12(7)4-3-9(13)14/h1-2,5H,3-4H2,(H,13,14)(H2,11,16,17)

InChI key: InChIKey=WKRIYKYDPGIKRA-UHFFFAOYSA-N

SMILES: C(CC(O)=O)N1C=2C(=CC(S(N)(=O)=O)=CC2)OC1=O

Synonyms:

• 3(2H)-Benzoxazolepropanoic acid, 6-(aminosulfonyl)-2-oxo-
• 6-(Aminosulfonyl)-2-oxo-3(2H)-benzoxazolepropanoic acid

3-(2-Oxo-6-sulfamoyl-2,3-dihydro-1,3-benzoxazol-3-yl)propanoic acid

CAS: 929975-45-1

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₆S

Purity: Min. 95%

Molecular weight: 286.26 g/mol

Ref: 3D-EMB97545