CAS 929975-64-4

1H-Pyrazolo[3,4-b]pyridin-6-ol, 1-(1-cyclopropylethyl)-4-methyl-, 6-(4-methylbenzenesulfonate)

Description:

1H-Pyrazolo[3,4-b]pyridin-6-ol, 1-(1-cyclopropylethyl)-4-methyl-, 6-(4-methylbenzenesulfonate) is a complex organic compound characterized by its pyrazolo-pyridine core structure, which incorporates both a hydroxyl group and a sulfonate moiety. This compound features a cyclopropyl group and a methyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the sulfonate group enhances its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The compound's structure suggests potential interactions with biological targets, which may be explored for therapeutic purposes. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, this compound exemplifies the complexity and diversity of modern organic synthesis, with implications for pharmacological research and development.

Formula: C₁₉H₂₁N₃O₃S

InChI: InChI=1S/C19H21N3O3S/c1-12-4-8-16(9-5-12)26(23,24)25-18-10-13(2)17-11-20-22(19(17)21-18)14(3)15-6-7-15/h4-5,8-11,14-15H,6-7H2,1-3H3

InChI key: InChIKey=SAJHJTIVNJWMTM-UHFFFAOYSA-N

SMILES: C(C)(N1C=2C(=C(C)C=C(OS(=O)(=O)C3=CC=C(C)C=C3)N2)C=N1)C4CC4

Synonyms:

• 1H-Pyrazolo[3,4-b]pyridin-6-ol, 1-(1-cyclopropylethyl)-4-methyl-, 6-(4-methylbenzenesulfonate)