CAS 929975-66-6

4-[(Imidazo[1,2-a]pyridin-2-ylmethyl)thio]benzoic acid

Description:

4-[(Imidazo[1,2-a]pyridin-2-ylmethyl)thio]benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety linked to a thioether group that is further connected to an imidazo[1,2-a]pyridine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential biological activity. The presence of the imidazo[1,2-a]pyridine structure suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The thioether linkage may influence its solubility and reactivity, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions. Overall, this compound may exhibit a range of chemical behaviors, including potential acidity, nucleophilicity, and the ability to form complexes with metal ions or other substrates, which could be relevant for various applications in pharmaceuticals or materials science. Further studies would be necessary to elucidate its specific properties and potential uses.

Formula: C₁₅H₁₂N₂O₂S

InChI: InChI=1S/C15H12N2O2S/c18-15(19)11-4-6-13(7-5-11)20-10-12-9-17-8-2-1-3-14(17)16-12/h1-9H,10H2,(H,18,19)

InChI key: InChIKey=MIJFWPPINOKNBT-UHFFFAOYSA-N

SMILES: C(SC1=CC=C(C(O)=O)C=C1)C=2N=C3N(C2)C=CC=C3

Synonyms:

• Benzoic acid, 4-[(imidazo[1,2-a]pyridin-2-ylmethyl)thio]-
• 4-[(Imidazo[1,2-a]pyridin-2-ylmethyl)thio]benzoic acid