CAS 929975-74-6

1,1-Dimethylethyl N-[3-(4-methoxyphenyl)-2-propyn-1-yl]carbamate

Description:

1,1-Dimethylethyl N-[3-(4-methoxyphenyl)-2-propyn-1-yl]carbamate, with the CAS number 929975-74-6, is a chemical compound characterized by its unique structure that includes a carbamate functional group. This compound features a tert-butyl group (1,1-dimethylethyl) which contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of a propynyl moiety and a methoxyphenyl group suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, including nucleophilic substitutions or coupling reactions. The methoxy group can enhance the compound's lipophilicity, which may affect its biological activity and interaction with other molecules. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound may have applications in fields such as pharmaceuticals or agrochemicals, where its specific structural features could be leveraged for desired biological effects or chemical transformations.

Formula: C₁₅H₁₉NO₃

InChI: InChI=1S/C15H19NO3/c1-15(2,3)19-14(17)16-11-5-6-12-7-9-13(18-4)10-8-12/h7-10H,11H2,1-4H3,(H,16,17)

InChI key: InChIKey=WJINLHQWUAJFFG-UHFFFAOYSA-N

SMILES: C(#CCNC(OC(C)(C)C)=O)C1=CC=C(OC)C=C1

Synonyms:

• Carbamic acid, N-[3-(4-methoxyphenyl)-2-propyn-1-yl]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl N-[3-(4-methoxyphenyl)-2-propyn-1-yl]carbamate

tert-Butyl N-[3-(4-methoxyphenyl)prop-2-yn-1-yl]carbamate

CAS: 929975-74-6

Versatile small molecule scaffold

Formula: C₁₅H₁₉NO₃

Purity: Min. 95%

Molecular weight: 261.32 g/mol

Ref: 3D-EMB97574