CAS 929975-76-8

1-[(2-Chloro-3-pyridinyl)sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[(2-Chloro-3-pyridinyl)sulfonyl]-4-piperidinecarboxylic acid, identified by its CAS number 929975-76-8, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a sulfonyl group attached to a pyridine ring, indicating its potential as a sulfonamide derivative. The presence of the chloro substituent on the pyridine ring enhances its reactivity and may influence its biological activity. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its acidic carboxylic group suggests it may participate in hydrogen bonding and ionic interactions, which are crucial for its solubility and interaction with biological macromolecules. Overall, this compound's unique combination of functional groups positions it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₁H₁₃ClN₂O₄S

InChI: InChI=1S/C11H13ClN2O4S/c12-10-9(2-1-5-13-10)19(17,18)14-6-3-8(4-7-14)11(15)16/h1-2,5,8H,3-4,6-7H2,(H,15,16)

InChI key: InChIKey=FJUSTOBRWWALKK-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CCC(C(O)=O)CC1)C2=C(Cl)N=CC=C2

Synonyms:

• 1-[(2-Chloro-3-pyridinyl)sulfonyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(2-chloro-3-pyridinyl)sulfonyl]-

1-[(2-Chloropyridin-3-yl)sulfonyl]piperidine-4-carboxylic acid

CAS: 929975-76-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃ClN₂O₄S

Purity: Min. 95%

Molecular weight: 304.75 g/mol

Ref: 3D-EMB97576