CAS 929975-80-4

1-Ethyl-1,2,3,4-tetrahydro-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid

Description:

1-Ethyl-1,2,3,4-tetrahydro-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and contains two carbonyl (dioxo) functional groups that contribute to its reactivity and potential biological activity. The presence of a carboxylic acid group enhances its solubility in polar solvents and may influence its interaction with biological targets. The ethyl substituent at the nitrogen position can affect the compound's lipophilicity and overall pharmacokinetic properties. Such compounds are often of interest in medicinal chemistry due to their potential as bioactive agents, and their structural features may confer specific therapeutic effects. Additionally, the unique arrangement of atoms and functional groups may allow for various synthetic modifications, making it a versatile candidate for further research and development in drug discovery.

Formula: C₁₀H₉N₃O₄

InChI: InChI=1S/C10H9N3O4/c1-2-13-7-6(8(14)12-10(13)17)3-5(4-11-7)9(15)16/h3-4H,2H2,1H3,(H,15,16)(H,12,14,17)

InChI key: InChIKey=TZNKQRKDUNDNFN-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(=CC(C(O)=O)=CN2)C(=O)NC1=O

Synonyms:

• 1-Ethyl-1,2,3,4-tetrahydro-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylic acid
• 1-Ethyl-2,4-dioxo-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-6-carboxylic acid
• Pyrido[2,3-d]pyrimidine-6-carboxylic acid, 1-ethyl-1,2,3,4-tetrahydro-2,4-dioxo-
• 1-Ethyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylic acid

1-Ethyl-2,4-dioxo-1H,2H,3H,4H-pyrido[2,3-d]pyrimidine-6-carboxylic acid

CAS: 929975-80-4

Versatile small molecule scaffold

Formula: C₁₀H₉N₃O₄

Purity: Min. 95%

Molecular weight: 235.2 g/mol

Ref: 3D-EMB97580