CAS 929975-81-5

1-(Difluoromethyl)-1H-benzimidazole-2-acetonitrile

Description:

1-(Difluoromethyl)-1H-benzimidazole-2-acetonitrile is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a difluoromethyl group and an acetonitrile functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the difluoromethyl group can enhance lipophilicity and influence biological activity, making it of interest in medicinal chemistry. The acetonitrile moiety may impart polar characteristics, affecting solubility in various solvents. Additionally, the compound may exhibit specific spectral properties, such as distinct absorption in UV-Vis spectroscopy and characteristic peaks in NMR spectroscopy due to the unique hydrogen and fluorine environments. Its potential applications could span pharmaceuticals, agrochemicals, or materials science, depending on the specific interactions and reactivity it demonstrates in various chemical environments. As with any chemical substance, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can pose unique hazards.

Formula: C₁₀H₇F₂N₃

InChI: InChI=1S/C10H7F2N3/c11-10(12)15-8-4-2-1-3-7(8)14-9(15)5-6-13/h1-4,10H,5H2

InChI key: InChIKey=XJOCJOKXQLDZAU-UHFFFAOYSA-N

SMILES: C(F)(F)N1C=2C(N=C1CC#N)=CC=CC2

Synonyms:

• [1-(Difluoromethyl)-1H-benzimidazol-2-yl]acetonitrile
• 2-[1-(Difluoromethyl)-1H-1,3-benzodiazol-2-yl]acetonitrile
• 1-(Difluoromethyl)-1H-benzimidazole-2-acetonitrile
• 1H-Benzimidazole-2-acetonitrile, 1-(difluoromethyl)-

2-[1-(Difluoromethyl)-1H-1,3-benzodiazol-2-yl]acetonitrile

Controlled Product

CAS: 929975-81-5

Versatile small molecule scaffold

Formula: C₁₀H₇F₂N₃

Purity: Min. 95%

Molecular weight: 207.18 g/mol

Ref: 3D-EMB97581