CAS 929976-63-6

4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid

Description:

4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid, with CAS number 929976-63-6, is a synthetic organic compound characterized by its unique structure that includes a cyclopentene ring and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis as a building block due to the presence of the carboxylic acid functional group, which can participate in coupling reactions. The Fmoc group serves as a protective moiety for the amine, allowing for selective reactions without interfering with the carboxylic acid functionality. The cyclopentene moiety contributes to the compound's rigidity and can influence its reactivity and interaction with other molecules. Additionally, the compound's solubility and stability are important characteristics that affect its application in various chemical reactions and synthesis processes. Overall, this compound is significant in the field of organic chemistry, particularly in the synthesis of complex peptides and other bioactive molecules.

Formula: C₂₁H₁₉NO₄

InChI: InChI=1S/C21H19NO4/c23-20(24)13-9-10-14(11-13)22-21(25)26-12-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,13-14,19H,11-12H2,(H,22,25)(H,23,24)

InChI key: InChIKey=IWMUNNGMJRKNSV-UHFFFAOYSA-N

SMILES: C(OC(NC1CC(C(O)=O)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• 2-Cyclopentene-1-carboxylic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-
• 4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-cyclopentene-1-carboxylic acid

4-({[(9H-Fluoren-9-yl)methoxy]carbonyl}amino)cyclopent-2-ene-1-carboxylic acid

CAS: 929976-63-6

Versatile small molecule scaffold

Formula: C₂₁H₁₉NO₄

Purity: Min. 95%

Molecular weight: 349.4 g/mol

Ref: 3D-EMB97663