CAS 93-34-5
:Benzenediazonium, 5-chloro-2-methoxy-, chloride (1:1)
Description:
Benzenediazonium, 5-chloro-2-methoxy-, chloride (1:1), commonly referred to as a diazonium salt, is an organic compound characterized by its diazonium functional group, which is a highly reactive species. This compound features a benzene ring substituted with a chlorine atom at the 5-position and a methoxy group at the 2-position, contributing to its unique reactivity and properties. The presence of the diazonium group makes it particularly useful in various organic synthesis reactions, including azo coupling, where it can react with aromatic compounds to form azo dyes. The chloride ion in the formula indicates that it is a salt, which can influence its solubility and stability in different solvents. Generally, diazonium salts are sensitive to heat and light, and they can decompose to release nitrogen gas, making them useful intermediates in synthetic organic chemistry. Safety precautions are necessary when handling this compound due to its potential reactivity and toxicity.
Formula:C7H6ClN2O·Cl
InChI:InChI=1S/C7H6ClN2O.ClH/c1-11-7-3-2-5(8)4-6(7)10-9;/h2-4H,1H3;1H/q+1;/p-1
InChI key:InChIKey=MLQLFEBDEPZXFY-UHFFFAOYSA-M
SMILES:O(C)C1=C([N+]#N)C=C(Cl)C=C1.[Cl-]
Synonyms:- 5-Chloro-2-Methoxybenzenediazonium Chloride
- Azoic Diazo Component 10
- Benzenediazonium, 5-chloro-2-methoxy-, chloride
- Benzenediazonium, 5-chloro-2-methoxy-, chloride (1:1)
- Diazo Red C
- Diazo Red RC
- Fast Red RC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
