CAS 93-77-6

2-[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid

Description:

2-[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid, with the CAS number 93-77-6, is an organic compound characterized by its thioether and carboxylic acid functional groups. This substance features a thioether linkage, where a sulfur atom is bonded to a phenyl ring that is further substituted with chlorine and methyl groups, contributing to its unique chemical properties. The presence of the carboxylic acid group (-COOH) imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid. Its structural features suggest potential applications in pharmaceuticals or agrochemicals, particularly in the development of compounds with specific biological activities. Safety data should be consulted for handling and usage, as the presence of chlorine and sulfur may pose certain hazards.

Formula: C₁₀H₁₁ClO₂S

InChI: InChI=1S/C10H11ClO2S/c1-6-4-9(14-5-10(12)13)7(2)3-8(6)11/h3-4H,5H2,1-2H3,(H,12,13)

InChI key: InChIKey=OEEPIGFTISQIKQ-UHFFFAOYSA-N

SMILES: S(CC(O)=O)C1=C(C)C=C(Cl)C(C)=C1

Synonyms:

• Acetic acid, [(4-chloro-2,5-dimethylphenyl)thio]-
• (4-Chloro-2,5-xylylmercapto)acetic acid
• 2-[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid
• Acetic acid, 2-[(4-chloro-2,5-dimethylphenyl)thio]-
• Acetic acid, [(4-chloro-2,5-xylyl)thio]-

[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid

CAS: 93-77-6

Formula: C₁₀H₁₁ClO₂S

Molecular weight: 230.7111

Ref: IN-DA00H0LP

[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid

CAS: 93-77-6

[(4-Chloro-2,5-dimethylphenyl)thio]acetic acid

Purity: 95%

Molecular weight: 230.71g/mol

Ref: 54-OR1003896