CAS 93-87-8
:D-Ribofuranose, 5-(dihydrogen phosphate)
Description:
D-Ribofuranose, 5-(dihydrogen phosphate), commonly referred to as ribose-5-phosphate, is a sugar phosphate that plays a crucial role in cellular metabolism, particularly in the pentose phosphate pathway. It is a pentose monosaccharide, specifically a five-carbon sugar, that exists predominantly in a furanose form. The presence of a phosphate group at the 5-position enhances its reactivity and solubility in aqueous solutions. This compound is essential for the synthesis of nucleotides and nucleic acids, serving as a building block for RNA and playing a role in energy transfer through ATP. Ribose-5-phosphate is also involved in various biochemical pathways, including the synthesis of amino acids and nucleotides. Its structure allows for various stereochemical configurations, contributing to its biological versatility. The CAS number 93-87-8 uniquely identifies this compound, facilitating its recognition in scientific literature and databases. Overall, D-Ribofuranose, 5-(dihydrogen phosphate) is integral to numerous metabolic processes, highlighting its importance in biochemistry and molecular biology.
Formula:C5H11O8P
InChI:InChI=1S/C5H11O8P/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5?/m1/s1
InChI key:InChIKey=KTVPXOYAKDPRHY-SOOFDHNKSA-N
SMILES:C(OP(=O)(O)O)[C@@H]1[C@@H](O)[C@@H](O)C(O)O1
Synonyms:- D-Ribofuranose, 5-(dihydrogen phosphate)
- Ribofuranose, 5-(dihydrogen phosphate), D-
- D-Ribofuranose 5-phosphate
- [Synonyms]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
D-Ribulose 5-phosphate sodium
CAS:Ribulose 5-phosphate sodium is a chemical that can be used to inhibit the enzyme ribulose phosphate reductase. Ribulose 5-phosphate sodium has been shown to inhibit glycolaldehyde production in the chloroplasts of plants, effectively reducing the amount of carbon dioxide produced. This chemical has also been shown to have an inhibitory effect on other enzymes involved in carbon fixation and assimilation. The effectiveness of this chemical is dependent on the specific plant species and environmental conditions.
Formula:C5H11O8P•NaxPurity:Min. 95%Color and Shape:PowderMolecular weight:230.11 g/molRef: 3D-AAA09387
Discontinued product

