CAS 930-46-1
:(1R,2R)-trans-1,2-cyclopentanediol
Description:
(1R,2R)-trans-1,2-cyclopentanediol is a bicyclic organic compound characterized by the presence of two hydroxyl (-OH) groups attached to a cyclopentane ring. This compound exhibits chirality, with specific stereochemistry denoted by the (1R,2R) configuration, indicating the spatial arrangement of its substituents. It is a colorless to pale yellow liquid at room temperature and is soluble in water due to the polar nature of the hydroxyl groups. The compound is often used in organic synthesis and as a chiral building block in the preparation of various pharmaceuticals and agrochemicals. Its unique structure allows for hydrogen bonding, which contributes to its solubility and reactivity. Additionally, (1R,2R)-trans-1,2-cyclopentanediol can participate in various chemical reactions, including oxidation and esterification, making it a versatile intermediate in synthetic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H10O2
InChI:InChI=1/C5H10O2/c6-4-2-1-3-5(4)7/h4-7H,1-3H2/t4-,5-/m1/s1
SMILES:C1C[C@H]([C@@H](C1)O)O
Synonyms:- (1R,2R)-cyclopentane-1,2-diol
- (1R)-Trans-1,2-Cyclopentanediol
- (1R,2R)-(-)-trans-1,2-cyclopentanediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(1R,2R)-trans-1,2-Cyclopentanediol
CAS:Controlled ProductFormula:C5H10O2Color and Shape:NeatMolecular weight:102.132
